Index of /archives/www.thevespiary.org/library/Files_Uploaded_by_Users/QuantumDude/Articles
![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | (GHB) reports on h..> | 2009-12-29 18:50 | 112K | |
| (S)-2-CHLOROALKANOIC..> | 2009-12-29 18:50 | 78K | |
| 0405Expt5.pdf | 2009-12-29 18:57 | 721K | |
| 1,4-DINITROBUTANE.pdf | 2009-12-29 18:52 | 131K | |
| 1-NITROOCTANE.pdf | 2009-12-29 18:50 | 138K | |
| 2-NITROETHANOL.pdf | 2009-12-29 18:52 | 137K | |
| 2-Oxopropanal oxime.pdf | 2009-12-29 18:53 | 50K | |
| 2-amino-5-Aryl-2-oxa..> | 2009-12-29 18:53 | 844K | |
| 2C-B Synth...pdf | 2009-12-29 18:53 | 47K | |
| 2C-B Synthesis (With..> | 2009-12-29 18:53 | 895K | |
| 2C-B synthesis witho..> | 2009-12-29 18:52 | 68K | |
| 3,4-Dibenzyloxy-b-ni..> | 2009-12-29 18:54 | 1.2M | |
| 3,4-Methylenedioxyph..> | 2009-12-29 18:53 | 31K | |
| 3-PHENYL-1-PROPANOL.pdf | 2009-12-29 18:53 | 33K | |
| 3-phenyl propyl alco..> | 2009-12-29 18:53 | 13K | |
![[ ]](/icons/unknown.gif) | 4-DMAR synthesis.doc | 2009-12-29 18:56 | 45K | |
| 4-mars.doc | 2009-12-29 18:56 | 24K | |
| 73.pdf | 2009-12-29 18:57 | 213K | |
| 226_expt11_pro.pdf | 2009-12-29 18:57 | 110K | |
| 345-trimethoxynitroe..> | 2009-12-29 18:57 | 215K | |
| A Complete MDMA Synt..> | 2009-12-29 18:57 | 74K | |
| A Convenient Synthes..> | 2009-12-29 18:57 | 151K | |
| A New Method for Hal..> | 2009-12-29 18:57 | 378K | |
| A New Method for the..> | 2009-12-29 18:57 | 57K | |
| A New Method for the..> | 2009-12-29 18:57 | 136K | |
| A Working MDMA.doc | 2009-12-29 18:57 | 104K | |
| Alanine to Nitroetha..> | 2009-12-29 18:57 | 21K | |
| Allocaine.pdf | 2009-12-29 18:57 | 155K | |
| Ammonium Formate_ Ra..> | 2009-12-29 18:57 | 73K | |
| Amphetamine-Synthesi..> | 2009-12-29 19:38 | 59M | |
| Amphetamine sulphate..> | 2009-12-29 18:58 | 634K | |
| Amphetamine synthesi..> | 2009-12-29 19:01 | 2.9M | |
| An Efficient Route t..> | 2009-12-29 18:59 | 55K | |
| An Efficient and Pra..> | 2009-12-29 18:58 | 186K | |
| An Evaluation of the..> | 2009-12-29 18:59 | 619K | |
| An Evaluation of the..> | 2009-12-29 19:00 | 666K | |
| An Insight of the Re..> | 2009-12-29 18:59 | 160K | |
| Anise.Oil.Precursor_..> | 2009-12-29 19:00 | 105K | |
| Apparatus for the Di..> | 2009-12-29 18:59 | 114K | |
| Arylalkylamines prep..> | 2009-12-29 19:00 | 786K | |
| BROMOCYCLOPROPANE.pdf | 2009-12-29 19:01 | 59K | |
| Benzaldehydes from P..> | 2009-12-29 19:00 | 23K | |
| BromineWater.pdf | 2009-12-29 19:00 | 98K | |
| Caffeic acid as a MD..> | 2009-12-29 19:01 | 20K | |
| Calamus Root Essenti..> | 2009-12-29 19:01 | 20K | |
| Catalytic Hunsdiecke..> | 2009-12-29 19:01 | 134K | |
| Characterization of ..> | 2009-12-29 19:02 | 727K | |
| Clemminson method wi..> | 2009-12-29 19:02 | 109K | |
| Comparison of Iodina..> | 2009-12-29 19:02 | 75K | |
| Complete_MDMA_synthe..> | 2009-12-29 19:08 | 6.6M | |
| Correlation of New M..> | 2009-12-29 19:02 | 228K | |
| DEA Resources, Micro..> | 2009-12-29 19:02 | 117K | |
| DMMDA.doc | 2009-12-29 19:03 | 45K | |
| DMT.doc | 2009-12-29 19:03 | 231K | |
| Deactivation of sodi..> | 2009-12-29 19:02 | 93K | |
| Delepine Route to DM..> | 2009-12-29 19:02 | 32K | |
| Demethylation of Met..> | 2009-12-29 19:03 | 405K | |
| Dill Seed Oil.pdf | 2009-12-29 19:03 | 67K | |
| EFFICIENT METHYLATIO..> | 2009-12-29 19:04 | 122K | |
| ETHYL-NITROBUTYRATE.pdf | 2009-12-29 19:04 | 149K | |
| Eleusis_ Purificatio..> | 2009-12-29 19:03 | 10K | |
| Ethylenediammonium d..> | 2009-12-29 19:04 | 30K | |
| Ethylenediammonium d..> | 2009-12-29 19:04 | 31K | |
| Facile Oxidation of ..> | 2009-12-29 19:04 | 187K | |
| Friedel-Crafts Acyla..> | 2009-12-29 19:04 | 20K | |
| Further about Metham..> | 2009-12-29 19:04 | 198K | |
| Further studies on t..> | 2009-12-29 19:05 | 115K | |
| GBL from GABA.doc | 2009-12-29 19:04 | 32K | |
| GHB from MSG.pdf | 2009-12-29 19:04 | 110K | |
| GHB synthesis.doc | 2009-12-29 19:04 | 68K | |
| GrayJ.Chem.Soc.Trans..> | 2009-12-29 19:05 | 694K | |
| GrayJ.Chem.Soc.Trans..> | 2009-12-29 19:05 | 694K | |
| H3PO3, Only The Fact..> | 2009-12-29 19:05 | 150K | |
| H3PO3I2 Reduction of..> | 2009-12-29 19:05 | 114K | |
| Hg reduction of MDP2..> | 2009-12-29 19:05 | 17K | |
| How to make hydrochl..> | 2009-12-29 19:05 | 23K | |
| Hunsdiecker reaction..> | 2009-12-29 19:06 | 334K | |
| Hydrogenation review..> | 2009-12-29 19:11 | 6.3M | |
| ISONITROSOPROPIOPHEN..> | 2009-12-29 19:10 | 149K | |
| Improved Bromination..> | 2009-12-29 19:08 | 92K | |
| IngentaConnect A Con..> | 2009-12-29 19:10 | 19K | |
| In vitro Synthesis o..> | 2009-12-29 19:08 | 480K | |
| Iodination and Hydro..> | 2009-12-29 19:08 | 56K | |
| Is Metal Necessary i..> | 2009-12-29 19:09 | 181K | |
| Isomeric Phenylserin..> | 2009-12-29 19:09 | 640K | |
| Isomerization of Ald..> | 2009-12-29 19:10 | 1.3M | |
| Isomerization of Ald..> | 2009-12-29 19:10 | 1.3M | |
| KINETICS OF PHASE-TR..> | 2009-12-29 19:10 | 240K | |
| KmnO4_cold oxidation..> | 2009-12-29 19:10 | 103K | |
| Large-Scale Brominat..> | 2009-12-29 19:10 | 269K | |
| Lithium and amine me..> | 2009-12-29 19:10 | 120K | |
| MERCURY(II) OXIDE-MO..> | 2009-12-29 19:11 | 32K | |
| METHYL 5-BROMOVALERA..> | 2009-12-29 19:12 | 65K | |
| METHYLAMINE HYDROCHL..> | 2009-12-29 19:12 | 34K | |
| METHYL IODIDE.pdf | 2009-12-29 19:12 | 81K | |
| Magnesium-mediated o..> | 2009-12-29 19:12 | 1.3M | |
| Manganese (II) Catal..> | 2009-12-29 19:10 | 129K | |
| Manganese(III) compl..> | 2009-12-29 19:12 | 1.2M | |
| Mescaline.pdf | 2009-12-29 19:11 | 47K | |
| Methanol extraction ..> | 2009-12-29 19:12 | 308K | |
| Methcathinone_sodium..> | 2009-12-29 19:12 | 21K | |
| MethylMan crank synt..> | 2009-12-29 19:13 | 678K | |
| Methyl Phenyl Butano..> | 2009-12-29 19:12 | 109K | |
| Methylamine Hydrochl..> | 2009-12-29 19:12 | 83K | |
| Methylamine from Amm..> | 2009-12-29 19:12 | 43K | |
| Methylamine from Sul..> | 2009-12-29 19:13 | 1.6M | |
| Methylation of pheno..> | 2009-12-29 19:14 | 2.0M | |
| Methylation of salic..> | 2009-12-29 19:13 | 29K | |
| Methylenedioxybenzen..> | 2009-12-29 19:12 | 79K | |
| Microwave nitroaldol..> | 2009-12-29 19:13 | 228K | |
| Monomethylation of A..> | 2009-12-29 19:14 | 118K | |
| NITRO ALKENE DERIVAT..> | 2009-12-29 19:14 | 428K | |
| NITROETHANE synthesi..> | 2009-12-29 19:14 | 31K | |
| NITROSTYRENE.pdf | 2009-12-29 19:14 | 68K | |
| New OTC methylating ..> | 2009-12-29 19:13 | 25K | |
| Nitroalkane Preparat..> | 2009-12-29 19:14 | 63K | |
| Nitroalkanes.pdf | 2009-12-29 19:14 | 119K | |
| Nitroethane from die..> | 2009-12-29 19:14 | 25K | |
| Nitroethane from sod..> | 2009-12-29 19:14 | 375K | |
| OC Chapter 11.pdf | 2009-12-29 19:15 | 631K | |
| OLEYL ALCOHOL.pdf | 2009-12-29 19:14 | 69K | |
| Odorless substitutes..> | 2009-12-29 19:15 | 77K | |
| Opium - Poppy Cultiv..> | 2009-12-29 19:15 | 38K | |
| Otc Nitroethane Synt..> | 2009-12-29 19:15 | 6.1K | |
| Oxazolidines.pdf | 2009-12-29 19:16 | 559K | |
| Oxidation of propeny..> | 2009-12-29 19:17 | 58K | |
| P2P [Phenylacetone] ..> | 2009-12-29 19:18 | 163K | |
| P2P_2dogs.pdf | 2009-12-29 19:18 | 50K | |
| PERACID OXYDATION OF..> | 2009-12-29 19:19 | 19K | |
| PERACID OXYDATION OF..> | 2009-12-29 19:19 | 11K | |
| PPA_properties.pdf | 2009-12-29 19:21 | 343K | |
| PPA properties.pdf | 2009-12-29 19:25 | 5.3M | |
| PROPERTIES OF THE TH..> | 2009-12-29 19:22 | 285K | |
| PTC Oxidation of Alc..> | 2009-12-29 19:22 | 22K | |
| PTC Oxidation of Alc..> | 2009-12-29 19:22 | 20K | |
| Paraformaldehyde_nit..> | 2009-12-29 19:19 | 268K | |
| Parsley Seed oil.pdf | 2009-12-29 19:18 | 20K | |
| Phenyl-2-Propanone b..> | 2009-12-29 19:19 | 27K | |
| Phosphorous acid - W..> | 2009-12-29 19:20 | 97K | |
| Photo-Essay_ Methyla..> | 2009-12-29 19:20 | 218K | |
| Phthalimide.pdf | 2009-12-29 19:20 | 44K | |
| Phthalimide_2.pdf | 2009-12-29 19:20 | 123K | |
| Pics-nitromethane.doc | 2009-12-29 19:20 | 263K | |
| Piperonal and Safrol..> | 2009-12-29 19:20 | 42K | |
| Piperonylacetone fro..> | 2009-12-29 19:20 | 42K | |
| Practical synthesis ..> | 2009-12-29 19:21 | 310K | |
| Preparation_of_lucas..> | 2009-12-29 19:21 | 36K | |
| Preparation_of_nitro..> | 2009-12-29 19:21 | 76K | |
| Preparation of Hydra..> | 2009-12-29 19:20 | 95K | |
| Preparation of Lead(..> | 2009-12-29 19:21 | 35K | |
| Preparation of Lead(..> | 2009-12-29 19:21 | 24K | |
| Preparation of nitro..> | 2009-12-29 19:21 | 94K | |
| Procedures for the R..> | 2009-12-29 19:22 | 21K | |
| Process for preparin..> | 2009-12-29 19:21 | 74K | |
| Process for producti..> | 2009-12-29 19:21 | 214K | |
| Process for the Prep..> | 2009-12-29 19:21 | 106K | |
| Production of benzyl..> | 2009-12-29 19:21 | 184K | |
| Propenylbenzene Oxid..> | 2009-12-29 19:22 | 43K | |
| Pseudo-ephedrine ext..> | 2009-12-29 19:22 | 442K | |
| Pseudonitrosite FAQ ..> | 2009-12-29 19:22 | 77K | |
| Purification, Cyanog..> | 2009-12-29 19:23 | 833K | |
| Purification of Keto..> | 2009-12-29 19:22 | 17K | |
| RDX.pdf | 2009-12-29 19:23 | 229K | |
| REDUCTION OF CRGANIC..> | 2009-12-29 19:24 | 145K | |
| Ramgopal, et al, 'Me..> | 2009-12-29 19:23 | 102K | |
| Rapid and efficient ..> | 2009-12-29 19:23 | 176K | |
| Reactions of Tertiar..> | 2009-12-29 19:23 | 549K | |
| Reactions of beta-As..> | 2009-12-29 19:24 | 154K | |
| Recyclable Lucas Rea..> | 2009-12-29 19:23 | 29K | |
| Reduction of Nitro G..> | 2009-12-29 19:24 | 47K | |
| Reduction of Nitroal..> | 2009-12-29 19:24 | 128K | |
| Reduction of Nitroal..> | 2009-12-29 19:24 | 34K | |
| Reduction of Nitroal..> | 2009-12-29 19:24 | 144K | |
| Reductive Amination ..> | 2009-12-29 19:24 | 55K | |
| Reductive methylatio..> | 2009-12-29 19:24 | 98K | |
| Reductive methylatio..> | 2009-12-29 19:25 | 97K | |
| Resolution of Racemi..> | 2009-12-29 19:24 | 73K | |
| Safrole-Reference Se..> | 2009-12-29 19:24 | 33K | |
| Safrole-The Main Pre..> | 2009-12-29 19:25 | 214K | |
| Selective Brominatio..> | 2009-12-29 19:25 | 71K | |
| Silica gel induced i..> | 2009-12-29 19:26 | 391K | |
| Simple Glass to Fanc..> | 2009-12-29 19:25 | 232K | |
| Spot tests.pdf | 2009-12-29 19:25 | 56K | |
| Stecker degradation ..> | 2009-12-29 19:25 | 104K | |
| Stereoisomeric enric..> | 2009-12-29 19:26 | 143K | |
| Stoicheomtric Steve'..> | 2009-12-29 19:25 | 22K | |
| Study on reduction o..> | 2009-12-29 19:26 | 308K | |
| Successful 2C-B Synt..> | 2009-12-29 19:26 | 89K | |
| Sulfamic acid.pdf | 2009-12-29 19:27 | 702K | |
| Sulfur Trioxide synt..> | 2009-12-29 19:26 | 198K | |
| Swi1phen's Complete ..> | 2009-12-29 19:26 | 114K | |
| Synthesis of (1R_,2S..> | 2009-12-29 19:27 | 461K | |
| Synthesis of.pdf | 2009-12-29 19:27 | 215K | |
| Synthesis of 2-Amino..> | 2009-12-29 19:26 | 61K | |
| Synthesis of Aliphat..> | 2009-12-29 19:27 | 289K | |
| Synthesis of DMT (an..> | 2009-12-29 19:27 | 75K | |
| Synthesis of Ephedri..> | 2009-12-29 19:27 | 83K | |
| Synthesis of Nor(pse..> | 2009-12-29 19:27 | 77K | |
| Synthesis of Phenyl-..> | 2009-12-29 19:27 | 37K | |
| Synthesis of Tryptam..> | 2009-12-29 19:28 | 117K | |
| Synthesis of p-Pheny..> | 2009-12-29 19:28 | 396K | |
| Synthesis of para-fl..> | 2009-12-29 19:27 | 44K | |
| THE DEGRADATION OF C..> | 2009-12-29 19:31 | 2.9M | |
| THE WILLGERODT REACT..> | 2009-12-29 19:32 | 232K | |
| THF oxidation with c..> | 2009-12-29 19:32 | 24K | |
| TMA-2.doc | 2009-12-29 19:32 | 36K | |
| Tests for Carboxylic..> | 2009-12-29 19:28 | 69K | |
| Tests for amides or ..> | 2009-12-29 19:28 | 25K | |
| Thallium in organic ..> | 2009-12-29 19:28 | 322K | |
| The Background and C..> | 2009-12-29 19:31 | 1.3M | |
| The Decomposition of..> | 2009-12-29 19:29 | 674K | |
| The First Example of..> | 2009-12-29 19:29 | 163K | |
| The Formation of Car..> | 2009-12-29 19:30 | 820K | |
| The Haloform Reactio..> | 2009-12-29 19:31 | 1.7M | |
| The Mechanism of the..> | 2009-12-29 19:31 | 365K | |
| The Merck Index -Leu..> | 2009-12-29 19:31 | 75K | |
| The Methylenation of..> | 2009-12-29 19:32 | 362K | |
| The Oxidation of Alc..> | 2009-12-29 19:31 | 64K | |
| The Preparation of A..> | 2009-12-29 19:34 | 351K | |
| The Preparation of A..> | 2009-12-29 19:31 | 446K | |
| The Synthesis of bet..> | 2009-12-29 19:32 | 133K | |
| The_Reactivity_of_GH..> | 2009-12-29 19:32 | 273K | |
| The decarboxylation ..> | 2009-12-29 19:28 | 187K | |
| The reaction (Meth).pdf | 2009-12-29 19:32 | 288K | |
| US1405261.pdf | 2009-12-29 19:32 | 212K | |
| US1889678.pdf | 2009-12-29 19:32 | 155K | |
| US4465864.pdf | 2009-12-29 19:32 | 165K | |
| US20080039643.pdf | 2009-12-29 19:32 | 106K | |
| US pat. 4605759 phe..> | 2009-12-29 19:32 | 136K | |
| You & Lee, 'Halodeca..> | 2009-12-29 19:32 | 49K | |
| Zinc-Catalyzed Ammon..> | 2009-12-29 19:33 | 47K | |
| advice_agakori_2.doc | 2009-12-29 18:57 | 25K | |
| advice_workup_agakor..> | 2009-12-29 18:57 | 66K | |
| akabori procedure.pdf | 2009-12-29 18:58 | 1.0M | |
| almagation very good..> | 2009-12-29 18:57 | 43K | |
| amides hydrolysis.pdf | 2009-12-29 18:58 | 99K | |
| amides hydrolysis_2.pdf | 2009-12-29 18:58 | 150K | |
| amides hydrolysis_3.pdf | 2009-12-29 18:58 | 275K | |
| amph-analog-1.pdf | 2009-12-29 18:58 | 587K | |
| amphetamine_HPLC.pdf | 2009-12-29 18:58 | 171K | |
| anethole.2c-b.pdf | 2009-12-29 18:59 | 41K | |
| a new synthetis of a..> | 2009-12-29 18:57 | 214K | |
| a novel catalytic Hu..> | 2009-12-29 18:57 | 89K | |
| asarone.pdf | 2009-12-29 19:00 | 263K | |
| asarone_KMnO4.pdf | 2009-12-29 19:00 | 175K | |
| asarone_ketone_nitro..> | 2009-12-29 19:00 | 22K | |
| asarone epoxide.doc | 2009-12-29 19:00 | 205K | |
| beckmann_rearrangmen..> | 2009-12-29 19:00 | 113K | |
![[DIR]](/icons/folder.gif) | beckman related/ | 2024-08-30 04:40 | - | |
| benzaldehyde_cinnama..> | 2009-12-29 19:01 | 1.1M | |
| benzoquinone Wacker ..> | 2009-12-29 19:00 | 34K | |
| birch.inhibition.pat..> | 2009-12-29 19:01 | 915K | |
| bottle.doc | 2009-12-29 19:00 | 33K | |
| bromine.doc | 2009-12-29 19:00 | 109K | |
| bromosafrole+methyla..> | 2009-12-29 19:02 | 50K | |
| cannabinoids.pdf | 2009-12-29 19:01 | 546K | |
| cannabinoids_2.pdf | 2009-12-29 19:01 | 271K | |
| cannabinoids_3.pdf | 2009-12-29 19:01 | 517K | |
| catechol_safrole_syn..> | 2009-12-29 19:01 | 170K | |
| cold_heroin.pdf | 2009-12-29 19:02 | 457K | |
| dea.pdf | 2009-12-29 19:02 | 117K | |
| dea_4-mar.pdf | 2009-12-29 19:02 | 117K | |
| dehyd_3.pdf | 2009-12-29 19:02 | 17K | |
| dehydration.pdf | 2009-12-29 19:02 | 15K | |
| dehydration_2.pdf | 2009-12-29 19:02 | 181K | |
| dehydration of aldox..> | 2009-12-29 19:03 | 555K | |
| demethylation_thiour..> | 2009-12-29 19:03 | 106K | |
| diketone_2.pdf | 2009-12-29 19:03 | 116K | |
| diketone_3.pdf | 2009-12-29 19:03 | 144K | |
| diketone reduction.pdf | 2009-12-29 19:03 | 622K | |
| dragonfly.pdf | 2009-12-29 19:03 | 325K | |
| enzoquinone Wacker O..> | 2009-12-29 19:03 | 34K | |
| ephedrine_yeast.pdf | 2009-12-29 19:03 | 117K | |
| erlenmeyer_reaction.pdf | 2009-12-29 19:04 | 383K | |
| erlenmeyer reaction ..> | 2009-12-29 19:04 | 756K | |
| halogenation aldehyd..> | 2009-12-29 19:05 | 373K | |
| hoffmann/ | 2024-08-30 04:40 | - | |
| huffmann.pdf | 2009-12-29 19:06 | 350K | |
| hydroxamic acids.pdf | 2009-12-29 19:07 | 130K | |
| hydroxamic acids_2.pdf | 2009-12-29 19:08 | 2.3M | |
| hydroxamic acids_3.pdf | 2009-12-29 19:06 | 28K | |
| hydroxylamin otc.doc | 2009-12-29 19:07 | 307K | |
| hydroxylation of org..> | 2009-12-29 19:07 | 165K | |
| ie50342a005-sulfamat..> | 2009-12-29 19:08 | 705K | |
| iodoform.pdf | 2009-12-29 19:08 | 188K | |
| japanese_Reaction of..> | 2009-12-29 19:10 | 137K | |
| japanese_Reaction of..> | 2009-12-29 19:10 | 94K | |
| ketones from oxime.pdf | 2009-12-29 19:10 | 75K | |
| larocaine.pdf | 2009-12-29 19:10 | 155K | |
| leukart.doc | 2009-12-29 19:10 | 26K | |
| lpha H a logenation ..> | 2009-12-29 19:11 | 72K | |
| marquis.pdf | 2009-12-29 19:10 | 46K | |
| marquis_2.pdf | 2009-12-29 19:11 | 204K | |
| mayer's reagent.pdf | 2009-12-29 19:11 | 277K | |
| mayer.pdf | 2009-12-29 19:11 | 277K | |
| mescaline extraction..> | 2009-12-29 19:12 | 1.1M | |
| meth_h3po3.doc | 2009-12-29 19:11 | 29K | |
| methcathinone.doc | 2009-12-29 19:11 | 27K | |
| methods of producing..> | 2010-01-23 01:39 | 68K | |
| methylation of prima..> | 2009-12-29 19:12 | 98K | |
| n-chloroamides_using..> | 2010-05-12 06:03 | 113K | |
| nitriles.pdf | 2009-12-29 19:13 | 37K | |
| nitroethane_MSDS_INf..> | 2009-12-29 19:14 | 78K | |
| nitro group.pdf | 2009-12-29 19:18 | 4.5M | |
| nitroso_compounds.pdf | 2009-12-29 19:14 | 486K | |
| ntlc_ghb.pdf | 2009-12-29 19:14 | 112K | |
| one-pot deoxygenatio..> | 2009-12-29 19:16 | 927K | |
| organic_reactions_v3..> | 2009-12-29 19:20 | 5.3M | |
| organic rectiions I.pdf | 2009-12-29 19:19 | 4.1M | |
| oxidation_permangana..> | 2009-12-29 19:19 | 2.6M | |
| oxone.doc | 2009-12-29 19:18 | 58K | |
| pat05430189.pdf | 2009-12-29 19:19 | 786K | |
| patent_meth.pdf | 2009-12-29 19:20 | 955K | |
| phenylpropanolamine ..> | 2009-12-29 19:20 | 221K | |
| piperic acid from pi..> | 2009-12-29 19:20 | 20K | |
| proenylbenzene_kmno4..> | 2009-12-29 19:21 | 37K | |
| reduction of cinnami..> | 2009-12-29 19:24 | 293K | |
| reduction of nitrost..> | 2009-12-29 19:24 | 89K | |
| salt bridge.pdf | 2009-12-29 19:25 | 12K | |
| sandmayer_propanoic ..> | 2009-12-29 19:25 | 77K | |
| selenium dioxide.pdf | 2009-12-29 19:25 | 15K | |
| sesamin.pdf | 2009-12-29 19:25 | 78K | |
| sodium azide.pdf | 2009-12-29 19:25 | 171K | |
| solventfree.kmno4.ox..> | 2009-12-29 19:25 | 78K | |
| styrene.pdf | 2009-12-29 19:29 | 4.2M | |
| thf2gbl.pdf | 2009-12-29 19:32 | 115K | |
| wolf-kishner.pdf | 2009-12-29 19:32 | 321K | |
| wolf-kishner_HUANG-M..> | 2009-12-29 19:32 | 321K | |
| xMSDS-Selenium_dioxi..> | 2009-12-29 19:32 | 77K | |
|
|---|