![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Catalysts For Fine C..> | 2014-10-21 06:17 | 1.7M | |
| Chemical Process & D..> | 2014-10-21 06:27 | 2.2M | |
| Encyclopedic Diction..> | 2014-10-21 06:23 | 1.7M | |
| Handbook of Inorgani..> | 2014-10-21 06:29 | 6.4M | |
| Handbook of Preparat..> | 2014-10-21 06:21 | 10M | |
| Inorganic Preparatio..> | 2014-10-21 06:21 | 1.4M | |
| Inorganic Preparatio..> | 2014-10-21 06:31 | 1.6M | |
| Ionic Liquids in Syn..> | 2014-10-21 06:25 | 3.7M | |
| Laboratory Methods o..> | 2014-10-21 06:26 | 2.7M | |
| Logic of Chemical Sy..> | 2014-10-21 06:20 | 11M | |
| Manufacture of Chemi..> | 2014-10-21 06:21 | 825K | |
| Organic Synthesis/ | 2024-08-30 04:40 | - | |
| Preparation of Organ..> | 2014-10-21 06:23 | 3.1M | |
| Preperative Inorgani..> | 2014-10-21 06:29 | 19M | |
| Preperative Inorgani..> | 2014-10-21 06:36 | 19M | |
| Synthesis of Acetyle..> | 2014-10-21 06:16 | 1.9M | |
| The Nitro Group in O..> | 2014-10-21 06:30 | 4.5M | |
| Total Synthesis II (..> | 2014-10-21 06:22 | 2.0M | |
| synthesis.html | 2022-05-23 14:51 | 7.4K | |