![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 18_0895_peganum_rege..> | 2024-08-29 09:31 | 197K | |
| 4103-The-Wacker-Reac..> | 2024-08-29 09:31 | 368K | |
| 8799-native-saline-p..> | 2024-08-29 09:31 | 1.4M | |
| 1403578529_fact_shee..> | 2024-08-29 09:31 | 2.3M | |
| AAMI Home Certificat..> | 2024-08-29 09:31 | 959K | |
| AAMI Home Renewal Ac..> | 2024-08-29 09:31 | 1.9M | |
| AAMI_Lucky_Club_atta..> | 2024-08-29 09:31 | 552K | |
| Aboriginal-plant-use..> | 2024-08-29 09:31 | 366K | |
| Aboriginal-plantuse.pdf | 2024-08-29 09:31 | 1.0M | |
| Alcaloides.pdf | 2024-08-29 09:31 | 138K | |
| Alkaloids_Gener_Trop..> | 2024-08-29 09:31 | 2.0M | |
| Antinociceptive anti..> | 2024-08-29 09:31 | 971K | |
| Aussie Colours Comme..> | 2024-08-29 09:31 | 354K | |
| Aust_J_Herbal_Med_24..> | 2024-08-29 09:31 | 6.3M | |
| Australian wildflowe..> | 2024-08-29 09:31 | 1.2M | |
| BPOCchapter1.pdf | 2024-08-29 09:31 | 1.1M | |
| BPOCchapter2.pdf | 2024-08-29 09:31 | 648K | |
| BUSHTUCKER.pdf | 2024-08-29 09:31 | 1.0M | |
| Binder1_MPG_Guide_20..> | 2024-08-29 09:31 | 1.4M | |
| Biological-control-o..> | 2024-08-29 09:31 | 265K | |
| Brobst et al pp 1-4.pdf | 2024-08-29 09:31 | 184K | |
| BushTuckerPlantFactS..> | 2024-08-29 09:31 | 4.6M | |
| C1-basicguidetoskele..> | 2024-08-29 09:31 | 422K | |
| C3L6_Understanding_S..> | 2024-08-29 09:31 | 612K | |
| DrawingOrganicCompou..> | 2024-08-29 09:31 | 157K | |
| EOLSS.pdf | 2024-08-29 09:31 | 4.4M | |
| Edible-plants-factsh..> | 2024-08-29 09:31 | 111K | |
| Eng_ver_Simonienko.pdf | 2024-08-29 09:31 | 340K | |
| Entheogenic rituals,..> | 2024-08-29 09:31 | 154K | |
| Evidence for Ritual ..> | 2024-08-29 09:31 | 453K | |
| Extraction-And-Isola..> | 2024-08-29 09:31 | 415K | |
| Factsheet_on_Native_..> | 2024-08-29 09:31 | 286K | |
| Feeding_Native_Plant..> | 2024-08-29 09:31 | 385K | |
| Four new species of ..> | 2024-08-29 09:31 | 3.5M | |
| Fringing-Vegetation.pdf | 2024-08-29 09:31 | 3.4M | |
| GARDEN_OF_EDEN_ERRAT..> | 2024-08-29 09:31 | 70K | |
| Hallucinogens and TC..> | 2024-08-29 09:31 | 1.5M | |
| Hallucinogens and TC..> | 2024-08-29 09:31 | 1.5M | |
| Harmal.pdf | 2024-08-29 09:31 | 1.5M | |
| Harrison_Ptilotus_fl..> | 2024-08-29 09:31 | 3.1M | |
| How-to-plant-a-nativ..> | 2024-08-29 09:31 | 213K | |
| IJNSS-V4I1-01-pp-01-..> | 2024-08-29 09:31 | 448K | |
| ISBN 978-93-84648-6..> | 2024-08-29 09:31 | 2.4M | |
| Info for Potential S..> | 2024-08-29 09:31 | 42K | |
| Isolation and Identi..> | 2024-08-29 09:31 | 1.6M | |
| Isolation of Protobe..> | 2024-08-29 09:31 | 321K | |
| Klein_et_al_2015_Has..> | 2024-08-29 09:31 | 3.9M | |
| Lit_S_Ito_D1.pdf | 2024-08-29 09:31 | 8.3M | |
| MSIC_Pill_Identifier..> | 2024-08-29 09:31 | 247K | |
| Maitai_A toxicologic..> | 2024-08-29 09:31 | 7.7M | |
| March 31-drugs.pdf | 2024-08-29 09:31 | 4.3M | |
| Med-Plant-Monographs..> | 2024-08-29 09:31 | 11M | |
| Miscellaneous new sp..> | 2024-08-29 09:31 | 6.8M | |
| NDA073 New Psychoact..> | 2024-08-29 09:31 | 1.0M | |
| NapralertReport_Mesc..> | 2024-08-29 09:31 | 15K | |
| New combinations in ..> | 2024-08-29 09:31 | 299K | |
| Nurserynotes.pdf | 2024-08-29 09:31 | 121K | |
| Organic Chemistry - ..> | 2024-08-29 09:31 | 31M | |
| Plant of the week - ..> | 2024-08-29 09:31 | 612K | |
| Pruning_Guide.pdf | 2024-08-29 09:31 | 237K | |
| RBG_Botany_Training_..> | 2024-08-29 09:31 | 2.1M | |
| Sceletium-tortuosum.pdf | 2024-08-29 09:31 | 541K | |
| SeedCollecting.pdf | 2024-08-29 09:31 | 628K | |
| Seed Master List-1.pdf | 2024-08-29 09:31 | 220K | |
| Seed Master List.pdf | 2024-08-29 09:31 | 220K | |
| The Alkaloids Vol 1.pdf | 2024-08-29 09:31 | 9.5M | |
| The Open Hyperspace ..> | 2024-08-29 09:31 | 14M | |
| The_Compleat_Recreat..> | 2024-08-29 09:31 | 277K | |
| The_DMT_Handbook_201..> | 2024-08-29 09:31 | 1.8M | |
| The_chemistry_pharma..> | 2024-08-29 09:31 | 905K | |
| The salvia users gui..> | 2024-08-29 09:31 | 158K | |
| The type of Acacia a..> | 2024-08-29 09:31 | 15M | |
| Thumbs.db | 2024-08-29 09:31 | 40K | |
| Top_10_fascinating_A..> | 2024-08-29 09:31 | 293K | |
| Topic 6 Propagation ..> | 2024-08-29 09:31 | 501K | |
| Tube-Guide-for-Commo..> | 2024-08-29 09:31 | 542K | |
| Two new Acacia speci..> | 2024-08-29 09:31 | 4.2M | |
| Two new species of A..> | 2024-08-29 09:31 | 4.3M | |
| Vol2Issue3011.pdf | 2024-08-29 09:31 | 2.2M | |
| Weedy native plants ..> | 2024-08-29 09:31 | 228K | |
| acidbase.conc.pdf | 2024-08-29 09:31 | 13K | |
| addiction-poster-201..> | 2024-08-29 09:31 | 807K | |
| alkaloid bearing pla..> | 2024-08-29 09:31 | 7.2M | |
| alzheimers-poster-20..> | 2024-08-29 09:31 | 1.1M | |
| amanita.muscaria.rev..> | 2024-08-29 09:31 | 2.4M | |
| anethole.2c-b.pdf | 2024-08-29 09:31 | 41K | |
| anhydroushandling.pdf | 2024-08-29 09:31 | 172K | |
| antimicrobial plant ..> | 2024-08-29 09:31 | 765K | |
| antioxidants-04-0064..> | 2024-08-29 09:31 | 763K | |
| archaeobotany austra..> | 2024-08-29 09:31 | 221K | |
| aromatic.aldehyde.sy..> | 2024-08-29 09:31 | 1.8M | |
| article1380794937_As..> | 2024-08-29 09:31 | 466K | |
| aussie native plants..> | 2024-08-29 09:31 | 3.4M | |
| aussie plant bushfoo..> | 2024-08-29 09:31 | 548K | |
| aussie plant guides.pdf | 2024-08-29 09:31 | 1.9M | |
| beaufortia11.pdf | 2024-08-29 09:31 | 2.2M | |
| benzo metabolism.pdf | 2024-08-29 09:31 | 547K | |
| birch.inhibition.pat..> | 2024-08-29 09:31 | 915K | |
| birch.reaction.kinet..> | 2024-08-29 09:31 | 148K | |
| buchnerfunnel.pdf | 2024-08-29 09:31 | 153K | |
| bushfoods-1.pdf | 2024-08-29 09:31 | 181K | |
| bushfoods.pdf | 2024-08-29 09:31 | 181K | |
| chem.anti-diversion...> | 2024-08-29 09:31 | 547K | |
| chem aspects of alka..> | 2024-08-29 09:31 | 1.0M | |
| chemical-investigati..> | 2024-08-29 09:31 | 427K | |
| chemical_behaviour_o..> | 2024-08-29 09:31 | 169K | |
| chemical ecology of ..> | 2024-08-29 09:31 | 2.7M | |
| chemicalresistance.pdf | 2024-08-29 09:31 | 199K | |
| chempharmbull.50.92...> | 2024-08-29 09:31 | 104K | |
| clandestine.hcl.gas...> | 2024-08-29 09:31 | 884K | |
| claviceps.identifica..> | 2024-08-29 09:31 | 452K | |
| cocaineanalogs.pdf | 2024-08-29 09:31 | 5.6M | |
| coffee plant metabol..> | 2024-08-29 09:31 | 437K | |
| colortestreference.pdf | 2024-08-29 09:31 | 132K | |
| diss.pdf | 2024-08-29 09:31 | 3.4M | |
| dopamine-receptors-r..> | 2024-08-29 09:31 | 1.5M | |
| download-1.pdf | 2024-08-29 09:31 | 206 | |
| download;jsessionid=..> | 2024-08-29 09:31 | 68K | |
| downloadfile-1.pdf | 2024-08-29 09:31 | 1.2M | |
| downloadfile-2.pdf | 2024-08-29 09:31 | 2.0M | |
| downloadfile.pdf | 2024-08-29 09:31 | 3.6M | |
| drugs.and.poisons.pdf | 2024-08-29 09:31 | 1.9M | |
| entheogen review.pdf | 2024-08-29 09:31 | 3.3M | |
| eremoph112.pdf | 2024-08-29 09:31 | 18M | |
| eremoph113.pdf | 2024-08-29 09:31 | 4.6M | |
| eremoph114.pdf | 2024-08-29 09:31 | 2.7M | |
| ergot.alkaloid.biosy..> | 2024-08-29 09:31 | 4.5M | |
| ergot.alkaloids.chem..> | 2024-08-29 09:31 | 2.6M | |
| essential_psychedeli..> | 2024-08-29 09:31 | 1.1M | |
| fullintro.pdf | 2024-08-29 09:31 | 724K | |
| fumehood.pdf | 2024-08-29 09:31 | 322K | |
| gaba-receptors-revie..> | 2024-08-29 09:31 | 1.6M | |
| gaba-receptors-revie..> | 2024-08-29 09:31 | 1.6M | |
| geohuasca.pdf | 2024-08-29 09:31 | 539K | |
| groundglassware.pdf | 2024-08-29 09:31 | 41K | |
| hakea57.pdf | 2024-08-29 09:31 | 722K | |
| hakea59.pdf | 2024-08-29 09:31 | 334K | |
| hakea61.pdf | 2024-08-29 09:31 | 500K | |
| hydroamination.alken..> | 2024-08-29 09:31 | 3.8M | |
| hydroxycodeinone-1.pdf | 2024-08-29 09:31 | 767K | |
| hydroxycodeinone-2.pdf | 2024-08-29 09:31 | 176K | |
| ice-cooled.condenser..> | 2024-08-29 09:31 | 79K | |
| illicitdrugcode.au.pdf | 2024-08-29 09:31 | 302K | |
| interest-payment-pla..> | 2024-08-29 09:31 | 139K | |
| intro_flora_australi..> | 2024-08-29 09:31 | 3.1M | |
| isosafrole2piperonal..> | 2024-08-29 09:31 | 325K | |
| j.1471-4159.2004.027..> | 2024-08-29 09:31 | 350K | |
| jbc.M305717200.full.pdf | 2024-08-29 09:31 | 472K | |
| kugelrohr.cooling.pdf | 2024-08-29 09:31 | 61K | |
| landscaping_for_bush..> | 2024-08-29 09:31 | 5.6M | |
| lecture01_s05.pdf | 2024-08-29 09:31 | 789K | |
| lesson.pdf | 2024-08-29 09:31 | 418K | |
| leuckart.pdf | 2024-08-29 09:31 | 710K | |
| lsd.cobalt.pdf | 2024-08-29 09:31 | 239K | |
| lysergic.kurokawa.pdf | 2024-08-29 09:31 | 97K | |
| mA baker’s dozen o..> | 2024-08-29 09:31 | 15M | |
| mAcacia umbraculifor..> | 2024-08-29 09:31 | 1.0M | |
| malcolm_reed's_repor..> | 2024-08-29 09:31 | 103K | |
| manganese.epoxidatio..> | 2024-08-29 09:31 | 312K | |
| manual bag machine.pdf | 2024-08-29 09:31 | 262K | |
| manual vibrator plat..> | 2024-08-29 09:31 | 2.7M | |
| medicinal potential ..> | 2024-08-29 09:31 | 208K | |
| methamphetaminesynth..> | 2024-08-29 09:31 | 70K | |
| methanol.technical.i..> | 2024-08-29 09:31 | 2.6M | |
| methylenedioxycathin..> | 2024-08-29 09:31 | 887K | |
| mexican.peyote.cacti..> | 2024-08-29 09:31 | 4.6M | |
| microwave.chemistry...> | 2024-08-29 09:31 | 699K | |
| microwave.organic.ch..> | 2024-08-29 09:31 | 1.6M | |
| mono82-6A.pdf | 2024-08-29 09:31 | 100K | |
| mw.alc2ketone.clayco..> | 2024-08-29 09:31 | 132K | |
| mw.mno2.benzaldehyde..> | 2024-08-29 09:31 | 132K | |
| mw.nitroalkene.pdf | 2024-08-29 09:31 | 208K | |
| mw.tosylate.azidatio..> | 2024-08-29 09:31 | 28K | |
| mw.wolff-kishner.pdf | 2024-08-29 09:31 | 49K | |
| native plant harvest..> | 2024-08-29 09:31 | 1.1M | |
| neurodegeneration-gu..> | 2024-08-29 09:31 | 6.6M | |
| new-psychoactive-sub..> | 2024-08-29 09:31 | 550K | |
| onslow-flora.pdf | 2024-08-29 09:31 | 1.9M | |
| opioids_morphine.pdf | 2024-08-29 09:31 | 78K | |
| organic molcules and..> | 2024-08-29 09:31 | 2.9M | |
| pain-guide-2016-usd.pdf | 2024-08-29 09:31 | 2.8M | |
| parr.hydrogenation.a..> | 2024-08-29 09:31 | 1.8M | |
| parrshaker.pdf | 2024-08-29 09:31 | 209K | |
| pdfffff - Shortcut.lnk | 2024-08-29 09:31 | 910 | |
| peganam harmarla.pdf | 2024-08-29 09:31 | 133K | |
| pharmacognosy phytoc..> | 2024-08-29 09:31 | 233K | |
| pharmacological stud..> | 2024-08-29 09:31 | 716K | |
| phenol.nitration.pdf | 2024-08-29 09:31 | 35K | |
| phytochemical studie..> | 2024-08-29 09:31 | 3.6M | |
| phytochemistry of al..> | 2024-08-29 09:31 | 289K | |
| phytophlora wa.pdf | 2024-08-29 09:31 | 265K | |
| pirsacitrus.pdf | 2024-08-29 09:31 | 135K | |
| pka.listing.dmso.pdf | 2024-08-29 09:31 | 967K | |
| plant alkaloids.pdf | 2024-08-29 09:31 | 3.6M | |
| plants.pdf | 2024-08-29 09:31 | 471K | |
| precursor-incb.pdf | 2024-08-29 09:31 | 67K | |
| prodine.pdf | 2024-08-29 09:31 | 15K | |
| psilocin-psilocybin...> | 2024-08-29 09:31 | 62K | |
| psilocin.silylbutyne..> | 2024-08-29 09:31 | 51K | |
| re008.pdf | 2024-08-29 09:31 | 359K | |
| redamin.hg-cathode.pdf | 2024-08-29 09:31 | 232K | |
| revised terpenoids.pdf | 2024-08-29 09:31 | 250K | |
| rotary.evaporator.pdf | 2024-08-29 09:31 | 818K | |
| safe-parr.pdf | 2024-08-29 09:31 | 24K | |
| secondary.amine.synt..> | 2024-08-29 09:31 | 642K | |
| seedcollecting acaci..> | 2024-08-29 09:31 | 1.1M | |
| seed collection prop..> | 2024-08-29 09:31 | 256K | |
| shire_of_victoria_pl..> | 2024-08-29 09:31 | 2.6M | |
| shoot regeneration s..> | 2024-08-29 09:31 | 320K | |
| sildenafil.synthesis..> | 2024-08-29 09:31 | 275K | |
| solvent.miscibility.pdf | 2024-08-29 09:31 | 231K | |
| soxhlet4dummies.pdf | 2024-08-29 09:31 | 65K | |
| started.pdf | 2024-08-29 09:31 | 677K | |
| stelprdb5410106.pdf | 2024-08-29 09:31 | 1.7M | |
| still.pdf | 2024-08-29 09:31 | 639K | |
| substituted.diphenyl..> | 2024-08-29 09:31 | 82K | |
| substituted.diphenyl..> | 2024-08-29 09:31 | 82K | |
| tetratheca goldfield..> | 2024-08-29 09:31 | 444K | |
| the-organic-chem-lab..> | 2024-08-29 09:31 | 41K | |
| the.alkaloids.vol3.c..> | 2024-08-29 09:31 | 3.5M | |
| the.total.synthesis...> | 2024-08-29 09:31 | 6.0M | |
| the_plant_alkaloids.pdf | 2024-08-29 09:31 | 12M | |
| thf2gbl.pdf | 2024-08-29 09:31 | 115K | |
| thfrecovery.pdf | 2024-08-29 09:31 | 147K | |
| threatened australia..> | 2024-08-29 09:31 | 471K | |
| threo-methylphenidat..> | 2024-08-29 09:31 | 372K | |
| v08a_alk.pdf | 2024-08-29 09:31 | 191K | |
| wacker.propenylbenze..> | 2024-08-29 09:31 | 78K | |